About [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol
[4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol (PubChem CID 164807054) has the molecular formula C14H12N4O3S
and a molecular weight of 316.34 g/mol. Its IUPAC name is [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol |
| PubChem CID | 164807054 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol |
| SMILES | O=S(=O)(c1ccc(CO)cc1)n1cnc(-c2ccncc2)n1 |
| InChI | InChI=1S/C14H12N4O3S/c19-9-11-1-3-13(4-2-11)22(20,21)18-10-16-14(17-18)12-5-7-15-8-6-12/h1-8,10,19H,9H2 |
| InChIKey | SDHQLCDAYYTWLN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol?
The IUPAC name of [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol (CID 164807054) is [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol.
What is the SMILES notation for [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol?
The canonical SMILES for [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol is O=S(=O)(c1ccc(CO)cc1)n1cnc(-c2ccncc2)n1.
What is the InChIKey of [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol?
The InChIKey is SDHQLCDAYYTWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3S/c19-9-11-1-3-13(4-2-11)22(20,21)18-10-16-14(17-18)12-5-7-15-8-6-12/h1-8,10,19H,9H2.
What are the key properties of [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol?
[4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol has a molecular weight of 316.34 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3-pyridin-4-yl-1,2,4-triazol-1-yl)sulfonyl]phenyl]methanol is sourced from PubChem (CID 164807054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).