C15H10F3N3O2S — CID 164925366
1-(benzenesulfonyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 164925366) has the molecular formula C15H10F3N3O2S and a molecular weight of 353.33 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 1-(benzenesulfonyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 164925366 |
| Molecular Formula | C15H10F3N3O2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[4-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | O=S(=O)(c1ccccc1)n1cnc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C15H10F3N3O2S/c16-15(17,18)12-8-6-11(7-9-12)14-19-10-21(20-14)24(22,23)13-4-2-1-3-5-13/h1-10H |
| InChIKey | WWERPGVWVPRARJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |