C39H39BBrNS — CID 164807451
3-bromo-N,N-diphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzothiaborinin-7-amine (PubChem CID 164807451) has the molecular formula C39H39BBrNS and a molecular weight of 644.53 g/mol. Its IUPAC name is 3-bromo-N,N-diphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzothiaborinin-7-amine.
| Compound Name | 3-bromo-N,N-diphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzothiaborinin-7-amine |
|---|---|
| PubChem CID | 164807451 |
| Molecular Formula | C39H39BBrNS |
| Molecular Weight | 644.53 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 3-bromo-N,N-diphenyl-10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzothiaborinin-7-amine |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3ccc(Br)cc3Sc3cc(N(c4ccccc4)c4ccccc4)ccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C39H39BBrNS/c1-25(2)28-21-33(26(3)4)39(34(22-28)27(5)6)40-35-19-17-29(41)23-37(35)43-38-24-32(18-20-36(38)40)42(30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-27H,1-6H3 |
| InChIKey | VCTLQDRKHMRQAZ-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.53 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|