About 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine
2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine (PubChem CID 163746219) has the molecular formula C28H32BBr
and a molecular weight of 459.28 g/mol. Its IUPAC name is 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine.
Molecular Properties
| Compound Name | 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine |
| PubChem CID | 163746219 |
| Molecular Formula | C28H32BBr |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3ccccc3Cc3cc(Br)ccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C28H32BBr/c1-17(2)21-15-24(18(3)4)28(25(16-21)19(5)6)29-26-10-8-7-9-20(26)13-22-14-23(30)11-12-27(22)29/h7-12,14-19H,13H2,1-6H3 |
| InChIKey | HONZOJXWLKMTIT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine?
The IUPAC name of 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine (CID 163746219) is 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine.
What is the SMILES notation for 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine?
The canonical SMILES for 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine is CC(C)c1cc(C(C)C)c(B2c3ccccc3Cc3cc(Br)ccc32)c(C(C)C)c1.
What is the InChIKey of 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine?
The InChIKey is HONZOJXWLKMTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32BBr/c1-17(2)21-15-24(18(3)4)28(25(16-21)19(5)6)29-26-10-8-7-9-20(26)13-22-14-23(30)11-12-27(22)29/h7-12,14-19H,13H2,1-6H3.
What are the key properties of 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine?
2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine has a molecular weight of 459.28 g/mol, XLogP of 6.24, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[2,4,6-tri(propan-2-yl)phenyl]-10H-benzo[b][1]benzoborinine is sourced from PubChem (CID 163746219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).