C31H39B — CID 102371944
2,3,7,8-tetramethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole (PubChem CID 102371944) has the molecular formula C31H39B and a molecular weight of 422.47 g/mol. Its IUPAC name is 2,3,7,8-tetramethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole.
| Compound Name | 2,3,7,8-tetramethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole |
|---|---|
| PubChem CID | 102371944 |
| Molecular Formula | C31H39B |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | 2,3,7,8-tetramethyl-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole |
| SMILES | Cc1cc2c(cc1C)-c1cc(C)c(C)cc1B2c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C31H39B/c1-17(2)24-15-25(18(3)4)31(26(16-24)19(5)6)32-29-13-22(9)20(7)11-27(29)28-12-21(8)23(10)14-30(28)32/h11-19H,1-10H3 |
| InChIKey | MGDJBKZQWMXJSB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|