C38H53BO — CID 58274021
3,7,8-trimethyl-2-octoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole (PubChem CID 58274021) has the molecular formula C38H53BO and a molecular weight of 536.65 g/mol. Its IUPAC name is 3,7,8-trimethyl-2-octoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole.
| Compound Name | 3,7,8-trimethyl-2-octoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole |
|---|---|
| PubChem CID | 58274021 |
| Molecular Formula | C38H53BO |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.42 |
| IUPAC Name | 3,7,8-trimethyl-2-octoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole |
| SMILES | CCCCCCCCOc1cc2c(cc1C)B(c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1cc(C)c(C)cc1-2 |
| InChI | InChI=1S/C38H53BO/c1-11-12-13-14-15-16-17-40-37-23-34-33-18-27(8)28(9)19-35(33)39(36(34)20-29(37)10)38-31(25(4)5)21-30(24(2)3)22-32(38)26(6)7/h18-26H,11-17H2,1-10H3 |
| InChIKey | TWXXTNDULNLLAG-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|