C33H48BBrO — CID 142846696
6-bromo-1-[4-butan-2-yl-2,6-di(propan-2-yl)phenyl]-2-methyl-5-octoxy-1-benzoborole (PubChem CID 142846696) has the molecular formula C33H48BBrO and a molecular weight of 551.46 g/mol. Its IUPAC name is 6-bromo-1-[4-butan-2-yl-2,6-di(propan-2-yl)phenyl]-2-methyl-5-octoxy-1-benzoborole.
| Compound Name | 6-bromo-1-[4-butan-2-yl-2,6-di(propan-2-yl)phenyl]-2-methyl-5-octoxy-1-benzoborole |
|---|---|
| PubChem CID | 142846696 |
| Molecular Formula | C33H48BBrO |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | 6-bromo-1-[4-butan-2-yl-2,6-di(propan-2-yl)phenyl]-2-methyl-5-octoxy-1-benzoborole |
| SMILES | CCCCCCCCOc1cc2c(cc1Br)B(c1c(C(C)C)cc(C(C)CC)cc1C(C)C)C(C)=C2 |
| InChI | InChI=1S/C33H48BBrO/c1-9-11-12-13-14-15-16-36-32-20-27-17-25(8)34(30(27)21-31(32)35)33-28(22(3)4)18-26(24(7)10-2)19-29(33)23(5)6/h17-24H,9-16H2,1-8H3 |
| InChIKey | VTHNJZOOFKEMTG-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|