C45H67BO2 — CID 58776474
3,7-dimethyl-2,8-dioctoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole (PubChem CID 58776474) has the molecular formula C45H67BO2 and a molecular weight of 650.84 g/mol. Its IUPAC name is 3,7-dimethyl-2,8-dioctoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole.
| Compound Name | 3,7-dimethyl-2,8-dioctoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole |
|---|---|
| PubChem CID | 58776474 |
| Molecular Formula | C45H67BO2 |
| Molecular Weight | 650.84 g/mol |
| Exact Mass | 650.52 |
| IUPAC Name | 3,7-dimethyl-2,8-dioctoxy-5-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1]benzoborole |
| SMILES | CCCCCCCCOc1cc2c(cc1C)B(c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1cc(C)c(OCCCCCCCC)cc1-2 |
| InChI | InChI=1S/C45H67BO2/c1-11-13-15-17-19-21-23-47-43-29-39-40-30-44(48-24-22-20-18-16-14-12-2)35(10)26-42(40)46(41(39)25-34(43)9)45-37(32(5)6)27-36(31(3)4)28-38(45)33(7)8/h25-33H,11-24H2,1-10H3 |
| InChIKey | JXHKLIMWIXVZKX-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.84 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|