C43H47B — CID 169288365
4,6-di(propan-2-yl)-8-[2,4,6-tri(propan-2-yl)phenyl]-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2(7),3,5,9(22),10,12(21),13,15(20),16,18-undecaene (PubChem CID 169288365) has the molecular formula C43H47B and a molecular weight of 574.66 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)-8-[2,4,6-tri(propan-2-yl)phenyl]-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2(7),3,5,9(22),10,12(21),13,15(20),16,18-undecaene.
| Compound Name | 4,6-di(propan-2-yl)-8-[2,4,6-tri(propan-2-yl)phenyl]-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2(7),3,5,9(22),10,12(21),13,15(20),16,18-undecaene |
|---|---|
| PubChem CID | 169288365 |
| Molecular Formula | C43H47B |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.38 |
| IUPAC Name | 4,6-di(propan-2-yl)-8-[2,4,6-tri(propan-2-yl)phenyl]-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2(7),3,5,9(22),10,12(21),13,15(20),16,18-undecaene |
| SMILES | CC(C)c1cc2c(c(C(C)C)c1)B(c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1ccc3ccc4cccc5cc-2c1c3c45 |
| InChI | InChI=1S/C43H47B/c1-23(2)31-19-33(25(5)6)42(34(20-31)26(7)8)44-38-17-16-29-15-14-28-12-11-13-30-18-36(41(38)40(29)39(28)30)37-22-32(24(3)4)21-35(27(9)10)43(37)44/h11-27H,1-10H3 |
| InChIKey | LMFOAHRKJDKVKE-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|