C28H17B — CID 169288071
3,4,5,6-tetradeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2,4,6,9(22),10,12(21),13,15(20),16,18-undecaene (PubChem CID 169288071) has the molecular formula C28H17B and a molecular weight of 373.31 g/mol. Its IUPAC name is 3,4,5,6-tetradeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2,4,6,9(22),10,12(21),13,15(20),16,18-undecaene.
| Compound Name | 3,4,5,6-tetradeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2,4,6,9(22),10,12(21),13,15(20),16,18-undecaene |
|---|---|
| PubChem CID | 169288071 |
| Molecular Formula | C28H17B |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3,4,5,6-tetradeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)-8-borahexacyclo[17.3.1.02,7.09,22.012,21.015,20]tricosa-1(23),2,4,6,9(22),10,12(21),13,15(20),16,18-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c(B2c3c([2H])c([2H])c([2H])c([2H])c3-c3cc4cccc5ccc6ccc2c3c6c54)c([2H])c1[2H] |
| InChI | InChI=1S/C28H17B/c1-2-9-21(10-3-1)29-24-12-5-4-11-22(24)23-17-20-8-6-7-18-13-14-19-15-16-25(29)28(23)27(19)26(18)20/h1-17H/i1D,2D,3D,4D,5D,9D,10D,11D,12D |
| InChIKey | OPEJDDVUIGTTHQ-VIUSOBOPSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|