C23H27BS3 — CID 177474477
2-[2,4,6-tri(propan-2-yl)phenyl]-4,8,12-trithia-2-boratricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraene (PubChem CID 177474477) has the molecular formula C23H27BS3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[2,4,6-tri(propan-2-yl)phenyl]-4,8,12-trithia-2-boratricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraene.
| Compound Name | 2-[2,4,6-tri(propan-2-yl)phenyl]-4,8,12-trithia-2-boratricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraene |
|---|---|
| PubChem CID | 177474477 |
| Molecular Formula | C23H27BS3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[2,4,6-tri(propan-2-yl)phenyl]-4,8,12-trithia-2-boratricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,10-tetraene |
| SMILES | CC(C)c1cc(C(C)C)c(B2c3sccc3Sc3ccsc32)c(C(C)C)c1 |
| InChI | InChI=1S/C23H27BS3/c1-13(2)16-11-17(14(3)4)21(18(12-16)15(5)6)24-22-19(7-9-25-22)27-20-8-10-26-23(20)24/h7-15H,1-6H3 |
| InChIKey | LSOVIPSQHHOYIK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|