C41H41BN2 — CID 58776588
8,22-dimethyl-15-[2,4,6-tri(propan-2-yl)phenyl]-5,25-diaza-15-boraheptacyclo[14.11.0.02,14.04,12.06,11.018,26.019,24]heptacosa-1(27),2,4(12),6(11),7,9,13,16,18(26),19(24),20,22-dodecaene (PubChem CID 58776588) has the molecular formula C41H41BN2 and a molecular weight of 572.61 g/mol. Its IUPAC name is 8,22-dimethyl-15-[2,4,6-tri(propan-2-yl)phenyl]-5,25-diaza-15-boraheptacyclo[14.11.0.02,14.04,12.06,11.018,26.019,24]heptacosa-1(27),2,4(12),6(11),7,9,13,16,18(26),19(24),20,22-dodecaene.
| Compound Name | 8,22-dimethyl-15-[2,4,6-tri(propan-2-yl)phenyl]-5,25-diaza-15-boraheptacyclo[14.11.0.02,14.04,12.06,11.018,26.019,24]heptacosa-1(27),2,4(12),6(11),7,9,13,16,18(26),19(24),20,22-dodecaene |
|---|---|
| PubChem CID | 58776588 |
| Molecular Formula | C41H41BN2 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 8,22-dimethyl-15-[2,4,6-tri(propan-2-yl)phenyl]-5,25-diaza-15-boraheptacyclo[14.11.0.02,14.04,12.06,11.018,26.019,24]heptacosa-1(27),2,4(12),6(11),7,9,13,16,18(26),19(24),20,22-dodecaene |
| SMILES | Cc1ccc2c(c1)[nH]c1cc3c(cc12)B(c1c(C(C)C)cc(C(C)C)cc1C(C)C)c1cc2c(cc1-3)[nH]c1cc(C)ccc12 |
| InChI | InChI=1S/C41H41BN2/c1-21(2)26-15-29(22(3)4)41(30(16-26)23(5)6)42-35-17-33-27-11-9-24(7)13-37(27)43-39(33)19-31(35)32-20-40-34(18-36(32)42)28-12-10-25(8)14-38(28)44-40/h9-23,43-44H,1-8H3 |
| InChIKey | JWIDMKZWGWJUTR-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|