C22H35N3O3 — CID 164809925
tert-butyl 3-[4-(2-amino-3-ethoxypropyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 164809925) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is tert-butyl 3-[4-(2-amino-3-ethoxypropyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[4-(2-amino-3-ethoxypropyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 164809925 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | tert-butyl 3-[4-(2-amino-3-ethoxypropyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOCC(N)Cc1ccc(N2CC3CCC(C2)N3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H35N3O3/c1-5-27-15-17(23)12-16-6-8-18(9-7-16)24-13-19-10-11-20(14-24)25(19)21(26)28-22(2,3)4/h6-9,17,19-20H,5,10-15,23H2,1-4H3 |
| InChIKey | GFVNUEKKLPRBHA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|