C20H27N3O2 — CID 167150532
tert-butyl 3-[4-(1-cyanoethyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 167150532) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is tert-butyl 3-[4-(1-cyanoethyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[4-(1-cyanoethyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 167150532 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | tert-butyl 3-[4-(1-cyanoethyl)phenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C#N)c1ccc(N2CC3CCC(C2)N3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O2/c1-14(11-21)15-5-7-16(8-6-15)22-12-17-9-10-18(13-22)23(17)19(24)25-20(2,3)4/h5-8,14,17-18H,9-10,12-13H2,1-4H3 |
| InChIKey | AWAHLCVZNWPVST-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|