C21H31IN2O2 — CID 163989040
tert-butyl 3-[4-(iodomethyl)-3-propylphenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 163989040) has the molecular formula C21H31IN2O2 and a molecular weight of 470.40 g/mol. Its IUPAC name is tert-butyl 3-[4-(iodomethyl)-3-propylphenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[4-(iodomethyl)-3-propylphenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 163989040 |
| Molecular Formula | C21H31IN2O2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | tert-butyl 3-[4-(iodomethyl)-3-propylphenyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCCc1cc(N2CC3CCC(C2)N3C(=O)OC(C)(C)C)ccc1CI |
| InChI | InChI=1S/C21H31IN2O2/c1-5-6-15-11-17(8-7-16(15)12-22)23-13-18-9-10-19(14-23)24(18)20(25)26-21(2,3)4/h7-8,11,18-19H,5-6,9-10,12-14H2,1-4H3 |
| InChIKey | TYXOKRZMGPSAQC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|