C29H31BF2N2O4 — CID 164810473
diethyl 12,12-difluoro-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene-10,14-dicarboxylate (PubChem CID 164810473) has the molecular formula C29H31BF2N2O4 and a molecular weight of 520.39 g/mol. Its IUPAC name is diethyl 12,12-difluoro-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene-10,14-dicarboxylate.
| Compound Name | diethyl 12,12-difluoro-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene-10,14-dicarboxylate |
|---|---|
| PubChem CID | 164810473 |
| Molecular Formula | C29H31BF2N2O4 |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | diethyl 12,12-difluoro-2-phenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4(9),10,14-pentaene-10,14-dicarboxylate |
| SMILES | CCOC(=O)C1=[N+]2C(=C(c3ccccc3)c3c4c(c(C(=O)OCC)n3[B-]2(F)F)CCCC4)C2=C1CCCC2 |
| InChI | InChI=1S/C29H31BF2N2O4/c1-3-37-28(35)26-21-16-10-8-14-19(21)24-23(18-12-6-5-7-13-18)25-20-15-9-11-17-22(20)27(29(36)38-4-2)34(25)30(31,32)33(24)26/h5-7,12-13H,3-4,8-11,14-17H2,1-2H3 |
| InChIKey | VHUDGPNBVHMDNZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|