C20H17F3N6O2S — CID 164811151
N-(4-pyrrolidin-1-ylphenyl)-5-[[5-(trifluoromethyl)pyridine-3-carbonyl]amino]thiadiazole-4-carboxamide (PubChem CID 164811151) has the molecular formula C20H17F3N6O2S and a molecular weight of 462.46 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)-5-[[5-(trifluoromethyl)pyridine-3-carbonyl]amino]thiadiazole-4-carboxamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)-5-[[5-(trifluoromethyl)pyridine-3-carbonyl]amino]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 164811151 |
| Molecular Formula | C20H17F3N6O2S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)-5-[[5-(trifluoromethyl)pyridine-3-carbonyl]amino]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1snnc1C(=O)Nc1ccc(N2CCCC2)cc1)c1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F3N6O2S/c21-20(22,23)13-9-12(10-24-11-13)17(30)26-19-16(27-28-32-19)18(31)25-14-3-5-15(6-4-14)29-7-1-2-8-29/h3-6,9-11H,1-2,7-8H2,(H,25,31)(H,26,30) |
| InChIKey | GXOPOUBTAKNOMO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|