C39H36N4O5 — CID 164811870
methyl 16-octyl-15,17-dioxo-7-(2-phenylethylcarbamoyl)-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate (PubChem CID 164811870) has the molecular formula C39H36N4O5 and a molecular weight of 640.74 g/mol. Its IUPAC name is methyl 16-octyl-15,17-dioxo-7-(2-phenylethylcarbamoyl)-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate.
| Compound Name | methyl 16-octyl-15,17-dioxo-7-(2-phenylethylcarbamoyl)-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate |
|---|---|
| PubChem CID | 164811870 |
| Molecular Formula | C39H36N4O5 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | methyl 16-octyl-15,17-dioxo-7-(2-phenylethylcarbamoyl)-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c4ncc(C(=O)OC)c5c(C(=O)NCCc6ccccc6)ccc(c6ncc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C39H36N4O5/c1-3-4-5-6-7-11-20-43-37(45)27-17-15-25-33-31(27)28(38(43)46)21-41-35(33)24-14-16-26(36(44)40-19-18-23-12-9-8-10-13-23)30-29(39(47)48-2)22-42-34(25)32(24)30/h8-10,12-17,21-22H,3-7,11,18-20H2,1-2H3,(H,40,44) |
| InChIKey | PVDHTRLYCBHBHB-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|