C36H22N2O8 — CID 167154319
5-O,14-O-dimethyl 7-O,16-O-diphenyl 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-5,7,14,16-tetracarboxylate (PubChem CID 167154319) has the molecular formula C36H22N2O8 and a molecular weight of 610.58 g/mol. Its IUPAC name is 5-O,14-O-dimethyl 7-O,16-O-diphenyl 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-5,7,14,16-tetracarboxylate.
| Compound Name | 5-O,14-O-dimethyl 7-O,16-O-diphenyl 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-5,7,14,16-tetracarboxylate |
|---|---|
| PubChem CID | 167154319 |
| Molecular Formula | C36H22N2O8 |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 5-O,14-O-dimethyl 7-O,16-O-diphenyl 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaene-5,7,14,16-tetracarboxylate |
| SMILES | COC(=O)c1cnc2c3ccc(C(=O)Oc4ccccc4)c4c(C(=O)OC)cnc(c5ccc(C(=O)Oc6ccccc6)c1c52)c43 |
| InChI | InChI=1S/C36H22N2O8/c1-43-33(39)25-17-37-31-22-14-16-24(36(42)46-20-11-7-4-8-12-20)28-26(34(40)44-2)18-38-32(30(22)28)21-13-15-23(27(25)29(21)31)35(41)45-19-9-5-3-6-10-19/h3-18H,1-2H3 |
| InChIKey | HIPAPJJPPBTSBT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|