C36H30N4O5 — CID 167154652
methyl 7-[2-(3-butylphenyl)ethylcarbamoyl]-16-methyl-15,17-dioxo-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate (PubChem CID 167154652) has the molecular formula C36H30N4O5 and a molecular weight of 598.66 g/mol. Its IUPAC name is methyl 7-[2-(3-butylphenyl)ethylcarbamoyl]-16-methyl-15,17-dioxo-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate.
| Compound Name | methyl 7-[2-(3-butylphenyl)ethylcarbamoyl]-16-methyl-15,17-dioxo-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate |
|---|---|
| PubChem CID | 167154652 |
| Molecular Formula | C36H30N4O5 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | methyl 7-[2-(3-butylphenyl)ethylcarbamoyl]-16-methyl-15,17-dioxo-3,12,16-triazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-5-carboxylate |
| SMILES | CCCCc1cccc(CCNC(=O)c2ccc3c4ncc5c6c(ccc(c7ncc(C(=O)OC)c2c37)c64)C(=O)N(C)C5=O)c1 |
| InChI | InChI=1S/C36H30N4O5/c1-4-5-7-19-8-6-9-20(16-19)14-15-37-33(41)23-12-10-21-29-27(23)26(36(44)45-3)18-39-31(29)22-11-13-24-28-25(17-38-32(21)30(22)28)35(43)40(2)34(24)42/h6,8-13,16-18H,4-5,7,14-15H2,1-3H3,(H,37,41) |
| InChIKey | KJMCPEIIINMCIM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|