C30H32N2O3 — CID 58526853
7-methyl-2-(4-methylcyclohexyl)-N-[2-(3-methylphenyl)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxamide (PubChem CID 58526853) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 7-methyl-2-(4-methylcyclohexyl)-N-[2-(3-methylphenyl)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxamide.
| Compound Name | 7-methyl-2-(4-methylcyclohexyl)-N-[2-(3-methylphenyl)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 58526853 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 7-methyl-2-(4-methylcyclohexyl)-N-[2-(3-methylphenyl)ethyl]-1,3-dioxobenzo[de]isoquinoline-6-carboxamide |
| SMILES | Cc1cccc(CCNC(=O)c2ccc3c4c(ccc(C)c24)C(=O)N(C2CCC(C)CC2)C3=O)c1 |
| InChI | InChI=1S/C30H32N2O3/c1-18-7-10-22(11-8-18)32-29(34)24-12-9-20(3)26-23(13-14-25(27(24)26)30(32)35)28(33)31-16-15-21-6-4-5-19(2)17-21/h4-6,9,12-14,17-18,22H,7-8,10-11,15-16H2,1-3H3,(H,31,33) |
| InChIKey | FFHHTOLPYXAVAL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|