C29H32N2OSi2 — CID 164815091
(16,16-dimethyl-2-trimethylsilyl-24-oxa-7,14-diazahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6,8,10,12,14,17(22),18,20-undecaen-20-yl)-trimethylsilane (PubChem CID 164815091) has the molecular formula C29H32N2OSi2 and a molecular weight of 480.76 g/mol. Its IUPAC name is (16,16-dimethyl-2-trimethylsilyl-24-oxa-7,14-diazahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6,8,10,12,14,17(22),18,20-undecaen-20-yl)-trimethylsilane.
| Compound Name | (16,16-dimethyl-2-trimethylsilyl-24-oxa-7,14-diazahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6,8,10,12,14,17(22),18,20-undecaen-20-yl)-trimethylsilane |
|---|---|
| PubChem CID | 164815091 |
| Molecular Formula | C29H32N2OSi2 |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (16,16-dimethyl-2-trimethylsilyl-24-oxa-7,14-diazahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6,8,10,12,14,17(22),18,20-undecaen-20-yl)-trimethylsilane |
| SMILES | CC1(C)c2nc3ccccc3nc2-c2ccc([Si](C)(C)C)c3oc4c([Si](C)(C)C)ccc1c4c23 |
| InChI | InChI=1S/C29H32N2OSi2/c1-29(2)18-14-16-22(34(6,7)8)27-24(18)23-17(13-15-21(26(23)32-27)33(3,4)5)25-28(29)31-20-12-10-9-11-19(20)30-25/h9-16H,1-8H3 |
| InChIKey | ZSVLIBNVZXNWIJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|