C28H27NOSi — CID 164814308
trimethyl-(11,16,16-trimethyl-24-oxa-7-azahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6(15),7,9,11,13,17(22),18,20-undecaen-20-yl)silane (PubChem CID 164814308) has the molecular formula C28H27NOSi and a molecular weight of 421.62 g/mol. Its IUPAC name is trimethyl-(11,16,16-trimethyl-24-oxa-7-azahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6(15),7,9,11,13,17(22),18,20-undecaen-20-yl)silane.
| Compound Name | trimethyl-(11,16,16-trimethyl-24-oxa-7-azahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6(15),7,9,11,13,17(22),18,20-undecaen-20-yl)silane |
|---|---|
| PubChem CID | 164814308 |
| Molecular Formula | C28H27NOSi |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | trimethyl-(11,16,16-trimethyl-24-oxa-7-azahexacyclo[19.2.1.05,23.06,15.08,13.017,22]tetracosa-1,3,5(23),6(15),7,9,11,13,17(22),18,20-undecaen-20-yl)silane |
| SMILES | Cc1ccc2nc3c(cc2c1)C(C)(C)c1ccc([Si](C)(C)C)c2oc4cccc-3c4c12 |
| InChI | InChI=1S/C28H27NOSi/c1-16-10-12-21-17(14-16)15-20-26(29-21)18-8-7-9-22-24(18)25-19(28(20,2)3)11-13-23(27(25)30-22)31(4,5)6/h7-15H,1-6H3 |
| InChIKey | DWGRTHFHFRJWEC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|