C38H45NO6P+ — CID 164817834
[(1S,4aR,10aR)-6,7-bis(phenylmethoxy)-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-1-ium-1-yl]methyl benzyl hydrogen phosphate (PubChem CID 164817834) has the molecular formula C38H45NO6P+ and a molecular weight of 642.75 g/mol. Its IUPAC name is [(1S,4aR,10aR)-6,7-bis(phenylmethoxy)-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-1-ium-1-yl]methyl benzyl hydrogen phosphate.
| Compound Name | [(1S,4aR,10aR)-6,7-bis(phenylmethoxy)-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-1-ium-1-yl]methyl benzyl hydrogen phosphate |
|---|---|
| PubChem CID | 164817834 |
| Molecular Formula | C38H45NO6P+ |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | [(1S,4aR,10aR)-6,7-bis(phenylmethoxy)-1-propyl-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-1-ium-1-yl]methyl benzyl hydrogen phosphate |
| SMILES | CCC[N@+]1(COP(=O)(O)OCc2ccccc2)CCC[C@@H]2Cc3c(ccc(OCc4ccccc4)c3OCc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C38H44NO6P/c1-2-22-39(29-45-46(40,41)44-28-32-17-10-5-11-18-32)23-12-19-34-24-35-33(25-36(34)39)20-21-37(42-26-30-13-6-3-7-14-30)38(35)43-27-31-15-8-4-9-16-31/h3-11,13-18,20-21,34,36H,2,12,19,22-29H2,1H3/p+1/t34-,36-,39-/m1/s1 |
| InChIKey | VKFLFWBDPVMOKW-IFXRHVSASA-O |
| XLogP | 8.24 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|