C15H20N2O3 — CID 164821490
benzyl N-[(1R,2S,3R)-3-hydroxy-8-azabicyclo[3.2.1]octan-2-yl]carbamate (PubChem CID 164821490) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is benzyl N-[(1R,2S,3R)-3-hydroxy-8-azabicyclo[3.2.1]octan-2-yl]carbamate.
| Compound Name | benzyl N-[(1R,2S,3R)-3-hydroxy-8-azabicyclo[3.2.1]octan-2-yl]carbamate |
|---|---|
| PubChem CID | 164821490 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | benzyl N-[(1R,2S,3R)-3-hydroxy-8-azabicyclo[3.2.1]octan-2-yl]carbamate |
| SMILES | O=C(N[C@@H]1[C@H](O)CC2CC[C@H]1N2)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c18-13-8-11-6-7-12(16-11)14(13)17-15(19)20-9-10-4-2-1-3-5-10/h1-5,11-14,16,18H,6-9H2,(H,17,19)/t11?,12-,13-,14+/m1/s1 |
| InChIKey | ZEKLFHBFBHVMDU-CPIKKWJDSA-N |
| XLogP | 1.17 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |