C10H17F3N2O2 — CID 164821528
3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)azetidine-1-carboxamide (PubChem CID 164821528) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)azetidine-1-carboxamide.
| Compound Name | 3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 164821528 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-hydroxy-N-[(2R)-3-methylbutan-2-yl]-3-(trifluoromethyl)azetidine-1-carboxamide |
| SMILES | CC(C)[C@@H](C)NC(=O)N1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-6(2)7(3)14-8(16)15-4-9(17,5-15)10(11,12)13/h6-7,17H,4-5H2,1-3H3,(H,14,16)/t7-/m1/s1 |
| InChIKey | HTFQMXDEYHIBCC-SSDOTTSWSA-N |
| XLogP | 1.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |