C7H11F3N2O2 — CID 164556299
N-ethyl-3-hydroxy-3-(trifluoromethyl)azetidine-1-carboxamide (PubChem CID 164556299) has the molecular formula C7H11F3N2O2 and a molecular weight of 212.17 g/mol. Its IUPAC name is N-ethyl-3-hydroxy-3-(trifluoromethyl)azetidine-1-carboxamide.
| Compound Name | N-ethyl-3-hydroxy-3-(trifluoromethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 164556299 |
| Molecular Formula | C7H11F3N2O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-ethyl-3-hydroxy-3-(trifluoromethyl)azetidine-1-carboxamide |
| SMILES | CCNC(=O)N1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3N2O2/c1-2-11-5(13)12-3-6(14,4-12)7(8,9)10/h14H,2-4H2,1H3,(H,11,13) |
| InChIKey | ICUXQCDEUOJDFW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |