C8H13F3N2O2 — CID 167135154
3-hydroxy-N-propan-2-yl-3-(trifluoromethyl)azetidine-1-carboxamide (PubChem CID 167135154) has the molecular formula C8H13F3N2O2 and a molecular weight of 226.20 g/mol. Its IUPAC name is 3-hydroxy-N-propan-2-yl-3-(trifluoromethyl)azetidine-1-carboxamide.
| Compound Name | 3-hydroxy-N-propan-2-yl-3-(trifluoromethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 167135154 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-hydroxy-N-propan-2-yl-3-(trifluoromethyl)azetidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H13F3N2O2/c1-5(2)12-6(14)13-3-7(15,4-13)8(9,10)11/h5,15H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | QLESTIKLLTUVCX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |