C34H20N2S — CID 164823121
2-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 164823121) has the molecular formula C34H20N2S and a molecular weight of 495.66 g/mol. Its IUPAC name is 2-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 164823121 |
| Molecular Formula | C34H20N2S |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[4-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3c(-c4ccc(-c5ccc6ccc7cccnc7c6n5)c5ccccc45)c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C34H20N2S/c1-2-9-24-23(8-1)25(28-11-5-12-29-27-10-3-4-13-31(27)37-34(28)29)17-18-26(24)30-19-16-22-15-14-21-7-6-20-35-32(21)33(22)36-30/h1-20H/i3D,4D,5D,10D,11D,12D,13D |
| InChIKey | LYUREHXEAMTOAC-PUOQHVAMSA-N |
| XLogP | 9.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|