C46H28N2O — CID 166509343
2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 166509343) has the molecular formula C46H28N2O and a molecular weight of 639.83 g/mol. Its IUPAC name is 2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166509343 |
| Molecular Formula | C46H28N2O |
| Molecular Weight | 639.83 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | 2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1c(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)oc(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c1-c1ccc(-c2ccc3ccc4cccnc4c3n2)c2ccccc12 |
| InChI | InChI=1S/C46H28N2O/c1-3-15-33-29(10-1)12-7-19-39(33)43-28-41(46(49-43)40-20-8-13-30-11-2-4-16-34(30)40)37-24-25-38(36-18-6-5-17-35(36)37)42-26-23-32-22-21-31-14-9-27-47-44(31)45(32)48-42/h1-28H/i1D,2D,3D,4D,7D,8D,10D,11D,12D,13D,15D,16D,19D,20D,28D |
| InChIKey | MLSMYJQNGFJQJV-RFOBUPQBSA-N |
| XLogP | 12.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.83 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|