C46H30N2O — CID 166509349
N-[2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-7-ethenylquinolin-8-yl]methanimine (PubChem CID 166509349) has the molecular formula C46H30N2O and a molecular weight of 641.85 g/mol. Its IUPAC name is N-[2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-7-ethenylquinolin-8-yl]methanimine.
| Compound Name | N-[2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-7-ethenylquinolin-8-yl]methanimine |
|---|---|
| PubChem CID | 166509349 |
| Molecular Formula | C46H30N2O |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | N-[2-[4-[4-deuterio-2,5-bis(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)furan-3-yl]naphthalen-1-yl]-7-ethenylquinolin-8-yl]methanimine |
| SMILES | [2H]c1c(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)oc(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c1-c1ccc(-c2ccc3ccc(C=C)c(N=C)c3n2)c2ccccc12 |
| InChI | InChI=1S/C46H30N2O/c1-3-29-22-23-32-24-27-42(48-45(32)44(29)47-2)38-26-25-37(35-18-8-9-19-36(35)38)41-28-43(39-20-10-14-30-12-4-6-16-33(30)39)49-46(41)40-21-11-15-31-13-5-7-17-34(31)40/h3-28H,1-2H2/i4D,5D,6D,7D,10D,11D,12D,13D,14D,15D,16D,17D,20D,21D,28D |
| InChIKey | SMLYFPHZWFBSBX-CUJHOZFSSA-N |
| XLogP | 12.93 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|