C38H43N3Zr — CID 164823239
[2,6-di(propan-2-yl)phenyl]-(pyrazin-2-ylmethyl)azanide;methanidylbenzene;zirconium(4+) (PubChem CID 164823239) has the molecular formula C38H43N3Zr and a molecular weight of 633.01 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-(pyrazin-2-ylmethyl)azanide;methanidylbenzene;zirconium(4+).
| Compound Name | [2,6-di(propan-2-yl)phenyl]-(pyrazin-2-ylmethyl)azanide;methanidylbenzene;zirconium(4+) |
|---|---|
| PubChem CID | 164823239 |
| Molecular Formula | C38H43N3Zr |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-(pyrazin-2-ylmethyl)azanide;methanidylbenzene;zirconium(4+) |
| SMILES | CC(C)c1cccc(C(C)C)c1[N-]Cc1cnccn1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C17H22N3.3C7H7.Zr/c1-12(2)15-6-5-7-16(13(3)4)17(15)20-11-14-10-18-8-9-19-14;3*1-7-5-3-2-4-6-7;/h5-10,12-13H,11H2,1-4H3;3*2-6H,1H2;/q4*-1;+4 |
| InChIKey | GWFHQFLEHDACAS-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|