C38H45N3Zr- — CID 168852870
1-(1,4-dimethylpyrazol-3-yl)ethyl-(2-methyl-6-propan-2-ylphenyl)azanide;methanidylbenzene;zirconium(3+) (PubChem CID 168852870) has the molecular formula C38H45N3Zr- and a molecular weight of 635.02 g/mol. Its IUPAC name is 1-(1,4-dimethylpyrazol-3-yl)ethyl-(2-methyl-6-propan-2-ylphenyl)azanide;methanidylbenzene;zirconium(3+).
| Compound Name | 1-(1,4-dimethylpyrazol-3-yl)ethyl-(2-methyl-6-propan-2-ylphenyl)azanide;methanidylbenzene;zirconium(3+) |
|---|---|
| PubChem CID | 168852870 |
| Molecular Formula | C38H45N3Zr- |
| Molecular Weight | 635.02 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | 1-(1,4-dimethylpyrazol-3-yl)ethyl-(2-methyl-6-propan-2-ylphenyl)azanide;methanidylbenzene;zirconium(3+) |
| SMILES | Cc1cn(C)nc1C(C)[N-]c1c(C)cccc1C(C)C.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Zr+3] |
| InChI | InChI=1S/C17H24N3.3C7H7.Zr/c1-11(2)15-9-7-8-12(3)17(15)18-14(5)16-13(4)10-20(6)19-16;3*1-7-5-3-2-4-6-7;/h7-11,14H,1-6H3;3*2-6H,1H2;/q4*-1;+3 |
| InChIKey | NWWZSUPTHMFGRF-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 31.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.02 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|