C13H16F2O2 — CID 164827498
(1S,3S)-2,2-difluoro-3-(2-methylpropyl)-1H-indene-1,3-diol (PubChem CID 164827498) has the molecular formula C13H16F2O2 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1S,3S)-2,2-difluoro-3-(2-methylpropyl)-1H-indene-1,3-diol.
| Compound Name | (1S,3S)-2,2-difluoro-3-(2-methylpropyl)-1H-indene-1,3-diol |
|---|---|
| PubChem CID | 164827498 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (1S,3S)-2,2-difluoro-3-(2-methylpropyl)-1H-indene-1,3-diol |
| SMILES | CC(C)C[C@]1(O)c2ccccc2[C@H](O)C1(F)F |
| InChI | InChI=1S/C13H16F2O2/c1-8(2)7-12(17)10-6-4-3-5-9(10)11(16)13(12,14)15/h3-6,8,11,16-17H,7H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | JUQDXPSPHVLLQR-RYUDHWBXSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |