C23H22ClN3O5S — CID 164827677
ethyl 4-[3-chloro-5-methoxy-4-[(E)-3-pyridin-4-ylprop-2-enoyl]oxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 164827677) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is ethyl 4-[3-chloro-5-methoxy-4-[(E)-3-pyridin-4-ylprop-2-enoyl]oxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-chloro-5-methoxy-4-[(E)-3-pyridin-4-ylprop-2-enoyl]oxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 164827677 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | ethyl 4-[3-chloro-5-methoxy-4-[(E)-3-pyridin-4-ylprop-2-enoyl]oxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)NC1c1cc(Cl)c(OC(=O)/C=C/c2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C23H22ClN3O5S/c1-4-31-22(29)19-13(2)26-23(33)27-20(19)15-11-16(24)21(17(12-15)30-3)32-18(28)6-5-14-7-9-25-10-8-14/h5-12,20H,4H2,1-3H3,(H2,26,27,33)/b6-5+ |
| InChIKey | GTODEEFGEMPMTM-AATRIKPKSA-N |
| XLogP | 3.72 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|