C21H17Cl2N3O5S — CID 174146245
4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)prop-2-enoyloxy]-5-methoxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylic acid (PubChem CID 174146245) has the molecular formula C21H17Cl2N3O5S and a molecular weight of 494.36 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)prop-2-enoyloxy]-5-methoxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)prop-2-enoyloxy]-5-methoxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 174146245 |
| Molecular Formula | C21H17Cl2N3O5S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)prop-2-enoyloxy]-5-methoxyphenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylic acid |
| SMILES | COc1cc(C2NC(=S)NC(C)=C2C(=O)O)cc(Cl)c1OC(=O)C=Cc1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N3O5S/c1-10-17(20(28)29)18(26-21(32)25-10)12-8-13(22)19(14(9-12)30-2)31-16(27)4-3-11-5-6-24-15(23)7-11/h3-9,18H,1-2H3,(H,28,29)(H2,25,26,32) |
| InChIKey | TVRKBSLEBWGEMR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|