C22H17N — CID 164831646
2,3,4,5,6,7,8-heptadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-amine (PubChem CID 164831646) has the molecular formula C22H17N and a molecular weight of 312.49 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 164831646 |
| Molecular Formula | C22H17N |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2c([2H])c([2H])c([2H])c([2H])c2[2H])c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C22H17N/c1-3-12-19(13-4-1)23(20-14-5-2-6-15-20)22-17-9-11-18-10-7-8-16-21(18)22/h1-17H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D |
| InChIKey | FGGAOQTXQHKQOW-YQVJVJADSA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |