About methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate
methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate (PubChem CID 164834256) has the molecular formula C20H28O4
and a molecular weight of 332.44 g/mol. Its IUPAC name is methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate |
| PubChem CID | 164834256 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(\Oc1cc(C2CCC(C)(C)CC2)ccc1C)C(=O)OC |
| InChI | InChI=1S/C20H28O4/c1-14-6-7-16(15-8-10-20(2,3)11-9-15)12-17(14)24-18(13-22-4)19(21)23-5/h6-7,12-13,15H,8-11H2,1-5H3/b18-13- |
| InChIKey | WSNWVXDAVWDFHK-AQTBWJFISA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate?
The IUPAC name of methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate (CID 164834256) is methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate.
What is the SMILES notation for methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate?
The canonical SMILES for methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate is CO/C=C(\Oc1cc(C2CCC(C)(C)CC2)ccc1C)C(=O)OC.
What is the InChIKey of methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate?
The InChIKey is WSNWVXDAVWDFHK-AQTBWJFISA-N. The full InChI is InChI=1S/C20H28O4/c1-14-6-7-16(15-8-10-20(2,3)11-9-15)12-17(14)24-18(13-22-4)19(21)23-5/h6-7,12-13,15H,8-11H2,1-5H3/b18-13-.
What are the key properties of methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate?
methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate has a molecular weight of 332.44 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-[5-(4,4-dimethylcyclohexyl)-2-methylphenoxy]-3-methoxyprop-2-enoate is sourced from PubChem (CID 164834256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).