C29H36F3N9O2S — CID 164834503
13-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 164834503) has the molecular formula C29H36F3N9O2S and a molecular weight of 631.73 g/mol. Its IUPAC name is 13-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 13-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 164834503 |
| Molecular Formula | C29H36F3N9O2S |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 13-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-2,5-dimethyl-9-(2,2,2-trifluoroethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | COc1cc(Nc2ncc3c(n2)N(C)c2sc(C)nc2C(=O)N3CC(F)(F)F)ccc1N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C29H36F3N9O2S/c1-18-34-24-26(42)41(17-29(30,31)32)22-16-33-28(36-25(22)38(3)27(24)44-18)35-19-5-6-21(23(15-19)43-4)40-9-7-20(8-10-40)39-13-11-37(2)12-14-39/h5-6,15-16,20H,7-14,17H2,1-4H3,(H,33,35,36) |
| InChIKey | CRNMPCFCKUPEPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|