C28H37N9OS — CID 167562852
2,5,9-trimethyl-13-[2-methyl-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 167562852) has the molecular formula C28H37N9OS and a molecular weight of 547.73 g/mol. Its IUPAC name is 2,5,9-trimethyl-13-[2-methyl-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 2,5,9-trimethyl-13-[2-methyl-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 167562852 |
| Molecular Formula | C28H37N9OS |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 2,5,9-trimethyl-13-[2-methyl-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | Cc1nc2c(s1)N(C)c1nc(Nc3ccc(N4CCN(C5CCN(C)CC5)CC4)cc3C)ncc1N(C)C2=O |
| InChI | InChI=1S/C28H37N9OS/c1-18-16-21(37-14-12-36(13-15-37)20-8-10-33(3)11-9-20)6-7-22(18)31-28-29-17-23-25(32-28)35(5)27-24(26(38)34(23)4)30-19(2)39-27/h6-7,16-17,20H,8-15H2,1-5H3,(H,29,31,32) |
| InChIKey | GFVFAXDHXPFJJS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|