C24H30N8OS — CID 167551121
2-ethyl-5,9-dimethyl-13-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 167551121) has the molecular formula C24H30N8OS and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-ethyl-5,9-dimethyl-13-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 2-ethyl-5,9-dimethyl-13-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 167551121 |
| Molecular Formula | C24H30N8OS |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-ethyl-5,9-dimethyl-13-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | CCN1c2nc(Nc3ccc(N4CCN(C)CC4)cc3C)ncc2N(C)C(=O)c2nc(C)sc21 |
| InChI | InChI=1S/C24H30N8OS/c1-6-32-21-19(30(5)22(33)20-23(32)34-16(3)26-20)14-25-24(28-21)27-18-8-7-17(13-15(18)2)31-11-9-29(4)10-12-31/h7-8,13-14H,6,9-12H2,1-5H3,(H,25,27,28) |
| InChIKey | FYUANKLZJKWPPI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|