C27H32N8O2S — CID 167570133
2,9-diethyl-5-methyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 167570133) has the molecular formula C27H32N8O2S and a molecular weight of 532.67 g/mol. Its IUPAC name is 2,9-diethyl-5-methyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 2,9-diethyl-5-methyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 167570133 |
| Molecular Formula | C27H32N8O2S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2,9-diethyl-5-methyl-13-[2-methyl-4-(4-prop-2-enoylpiperazin-1-yl)anilino]-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | C=CC(=O)N1CCN(c2ccc(Nc3ncc4c(n3)N(CC)c3sc(C)nc3C(=O)N4CC)c(C)c2)CC1 |
| InChI | InChI=1S/C27H32N8O2S/c1-6-22(36)33-13-11-32(12-14-33)19-9-10-20(17(4)15-19)30-27-28-16-21-24(31-27)35(8-3)26-23(29-18(5)38-26)25(37)34(21)7-2/h6,9-10,15-16H,1,7-8,11-14H2,2-5H3,(H,28,30,31) |
| InChIKey | GZYXKNIXGUPXIO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|