C23H29F3N3O+ — CID 164834730
triethyl-[[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methoxymethyl]phenyl]methyl]azanium (PubChem CID 164834730) has the molecular formula C23H29F3N3O+ and a molecular weight of 420.50 g/mol. Its IUPAC name is triethyl-[[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methoxymethyl]phenyl]methyl]azanium.
| Compound Name | triethyl-[[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methoxymethyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 164834730 |
| Molecular Formula | C23H29F3N3O+ |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | triethyl-[[2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methoxymethyl]phenyl]methyl]azanium |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1COCc1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C23H29F3N3O/c1-4-29(5-2,6-3)15-19-9-7-8-10-20(19)17-30-16-18-11-13-21(14-12-18)22(27-28-22)23(24,25)26/h7-14H,4-6,15-17H2,1-3H3/q+1 |
| InChIKey | QQMXONPLNBDRDP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|