C19H17F6NO6 — CID 164835813
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[6-(trifluoromethyl)-2-pyridinyl]phenoxy]oxane-3,4,5-triol (PubChem CID 164835813) has the molecular formula C19H17F6NO6 and a molecular weight of 469.33 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[6-(trifluoromethyl)-2-pyridinyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[6-(trifluoromethyl)-2-pyridinyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 164835813 |
| Molecular Formula | C19H17F6NO6 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[2-(trifluoromethyl)-4-[6-(trifluoromethyl)-2-pyridinyl]phenoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3cccc(C(F)(F)F)n3)cc2C(F)(F)F)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H17F6NO6/c20-18(21,22)9-6-8(10-2-1-3-13(26-10)19(23,24)25)4-5-11(9)31-17-16(30)15(29)14(28)12(7-27)32-17/h1-6,12,14-17,27-30H,7H2/t12-,14-,15+,16+,17+/m1/s1 |
| InChIKey | XEKIVUUGVKMLSW-ZUOZUFPHSA-N |
| XLogP | 1.96 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |