C52H36N4Si — CID 164843179
triphenyl-[2,3,4,5-tetradeuterio-6-[2,6-di(carbazol-9-yl)pyrimidin-4-yl]phenyl]silane (PubChem CID 164843179) has the molecular formula C52H36N4Si and a molecular weight of 749.00 g/mol. Its IUPAC name is triphenyl-[2,3,4,5-tetradeuterio-6-[2,6-di(carbazol-9-yl)pyrimidin-4-yl]phenyl]silane.
| Compound Name | triphenyl-[2,3,4,5-tetradeuterio-6-[2,6-di(carbazol-9-yl)pyrimidin-4-yl]phenyl]silane |
|---|---|
| PubChem CID | 164843179 |
| Molecular Formula | C52H36N4Si |
| Molecular Weight | 749.00 g/mol |
| Exact Mass | 748.30 |
| IUPAC Name | triphenyl-[2,3,4,5-tetradeuterio-6-[2,6-di(carbazol-9-yl)pyrimidin-4-yl]phenyl]silane |
| SMILES | [2H]c1c([2H])c([2H])c([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c(-c2cc(-n3c4ccccc4c4ccccc43)nc(-n3c4ccccc4c4ccccc43)n2)c1[2H] |
| InChI | InChI=1S/C52H36N4Si/c1-4-20-37(21-5-1)57(38-22-6-2-7-23-38,39-24-8-3-9-25-39)50-35-19-14-30-44(50)45-36-51(55-46-31-15-10-26-40(46)41-27-11-16-32-47(41)55)54-52(53-45)56-48-33-17-12-28-42(48)43-29-13-18-34-49(43)56/h1-36H/i14D,19D,30D,35D |
| InChIKey | WOHMVTZHACELIC-DBTCWWIYSA-N |
| XLogP | 9.72 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.00 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|