C18H19FN4 — CID 164844353
3-(cyclopropanecarboximidoyl)-6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoropyridine-2,6-diamine (PubChem CID 164844353) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-(cyclopropanecarboximidoyl)-6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoropyridine-2,6-diamine.
| Compound Name | 3-(cyclopropanecarboximidoyl)-6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoropyridine-2,6-diamine |
|---|---|
| PubChem CID | 164844353 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-(cyclopropanecarboximidoyl)-6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoropyridine-2,6-diamine |
| SMILES | [H]/N=C(/c1cc(F)c(Nc2cccc3c2CCC3)nc1N)C1CC1 |
| InChI | InChI=1S/C18H19FN4/c19-14-9-13(16(20)11-7-8-11)17(21)23-18(14)22-15-6-2-4-10-3-1-5-12(10)15/h2,4,6,9,11,20H,1,3,5,7-8H2,(H3,21,22,23)/b20-16+ |
| InChIKey | FVJYFMFAGGBCQP-CAPFRKAQSA-N |
| XLogP | 3.81 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|