C14H8ClFN4O — CID 164844386
2-chloro-5-fluoro-6-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]pyridine-3-carbonitrile (PubChem CID 164844386) has the molecular formula C14H8ClFN4O and a molecular weight of 302.70 g/mol. Its IUPAC name is 2-chloro-5-fluoro-6-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-5-fluoro-6-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164844386 |
| Molecular Formula | C14H8ClFN4O |
| Molecular Weight | 302.70 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-chloro-5-fluoro-6-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(F)c(Nc2cccc3c2CNC3=O)nc1Cl |
| InChI | InChI=1S/C14H8ClFN4O/c15-12-7(5-17)4-10(16)13(20-12)19-11-3-1-2-8-9(11)6-18-14(8)21/h1-4H,6H2,(H,18,21)(H,19,20) |
| InChIKey | WBOSVMUBPTXNPA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|