C59H44N4Pt — CID 164845420
9-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-methyl-4-phenyl-6-phenyl-2-pyridinyl)benzimidazol-2-yl]-4-phenyl-1H-carbazol-1-ide;platinum(2+) (PubChem CID 164845420) has the molecular formula C59H44N4Pt and a molecular weight of 1004.11 g/mol. Its IUPAC name is 9-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-methyl-4-phenyl-6-phenyl-2-pyridinyl)benzimidazol-2-yl]-4-phenyl-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-methyl-4-phenyl-6-phenyl-2-pyridinyl)benzimidazol-2-yl]-4-phenyl-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 164845420 |
| Molecular Formula | C59H44N4Pt |
| Molecular Weight | 1004.11 g/mol |
| Exact Mass | 1003.32 |
| IUPAC Name | 9-[1-(4-tert-butyl-2-phenylphenyl)-4-(3-methyl-4-phenyl-6-phenyl-2-pyridinyl)benzimidazol-2-yl]-4-phenyl-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1c(-c2ccccc2)cc(-c2[c-]cccc2)nc1-c1cccc2c1nc(-n1c3[c-]ccc(-c4ccccc4)c3c3ccccc31)n2-c1ccc(C(C)(C)C)cc1-c1ccccc1.[Pt+2] |
| InChI | InChI=1S/C59H44N4.Pt/c1-39-48(41-23-11-6-12-24-41)38-50(43-27-15-8-16-28-43)60-56(39)47-31-20-34-54-57(47)61-58(63(54)52-36-35-44(59(2,3)4)37-49(52)42-25-13-7-14-26-42)62-51-32-18-17-29-46(51)55-45(30-19-33-53(55)62)40-21-9-5-10-22-40;/h5-27,29-32,34-38H,1-4H3;/q-2;+2 |
| InChIKey | DWMYINKSSAYWRP-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.11 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|