C31H40N6O4 — CID 164846384
tert-butyl 2-[5-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]-4-(1,2,4-triazol-1-yl)anilino]pentoxy]acetate (PubChem CID 164846384) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is tert-butyl 2-[5-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]-4-(1,2,4-triazol-1-yl)anilino]pentoxy]acetate.
| Compound Name | tert-butyl 2-[5-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]-4-(1,2,4-triazol-1-yl)anilino]pentoxy]acetate |
|---|---|
| PubChem CID | 164846384 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | tert-butyl 2-[5-[N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]-4-(1,2,4-triazol-1-yl)anilino]pentoxy]acetate |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1NN(CCCCCOCC(=O)OC(C)(C)C)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C31H40N6O4/c1-22-10-11-25(30-23(2)35-41-24(30)3)18-28(22)34-36(26-12-14-27(15-13-26)37-21-32-20-33-37)16-8-7-9-17-39-19-29(38)40-31(4,5)6/h10-15,18,20-21,34H,7-9,16-17,19H2,1-6H3 |
| InChIKey | AABLXEWSJNUCPW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|