C11H10NO2Y- — CID 164848305
(10aR)-5,9,10,10a-tetrahydro-1H-[1,3]oxazolo[3,4-b]isoquinolin-9-id-3-one;yttrium (PubChem CID 164848305) has the molecular formula C11H10NO2Y- and a molecular weight of 277.11 g/mol. Its IUPAC name is (10aR)-5,9,10,10a-tetrahydro-1H-[1,3]oxazolo[3,4-b]isoquinolin-9-id-3-one;yttrium.
| Compound Name | (10aR)-5,9,10,10a-tetrahydro-1H-[1,3]oxazolo[3,4-b]isoquinolin-9-id-3-one;yttrium |
|---|---|
| PubChem CID | 164848305 |
| Molecular Formula | C11H10NO2Y- |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (10aR)-5,9,10,10a-tetrahydro-1H-[1,3]oxazolo[3,4-b]isoquinolin-9-id-3-one;yttrium |
| SMILES | O=C1OC[C@H]2Cc3[c-]cccc3CN12.[Y] |
| InChI | InChI=1S/C11H10NO2.Y/c13-11-12-6-9-4-2-1-3-8(9)5-10(12)7-14-11;/h1-2,4,10H,5-7H2;/q-1;/t10-;/m1./s1 |
| InChIKey | IHSPQFZYHQTGAE-HNCPQSOCSA-N |
| XLogP | 1.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|